C37H56N2O6 — CID 54538637
3-methoxy-N-[2-[(3-methoxy-4-octoxybenzoyl)amino]cyclopentyl]-4-octoxybenzamide (PubChem CID 54538637) has the molecular formula C37H56N2O6 and a molecular weight of 624.86 g/mol. Its IUPAC name is 3-methoxy-N-[2-[(3-methoxy-4-octoxybenzoyl)amino]cyclopentyl]-4-octoxybenzamide.
| Compound Name | 3-methoxy-N-[2-[(3-methoxy-4-octoxybenzoyl)amino]cyclopentyl]-4-octoxybenzamide |
|---|---|
| PubChem CID | 54538637 |
| Molecular Formula | C37H56N2O6 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.41 |
| IUPAC Name | 3-methoxy-N-[2-[(3-methoxy-4-octoxybenzoyl)amino]cyclopentyl]-4-octoxybenzamide |
| SMILES | CCCCCCCCOc1ccc(C(=O)NC2CCCC2NC(=O)c2ccc(OCCCCCCCC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C37H56N2O6/c1-5-7-9-11-13-15-24-44-32-22-20-28(26-34(32)42-3)36(40)38-30-18-17-19-31(30)39-37(41)29-21-23-33(35(27-29)43-4)45-25-16-14-12-10-8-6-2/h20-23,26-27,30-31H,5-19,24-25H2,1-4H3,(H,38,40)(H,39,41) |
| InChIKey | ZBNSVKSUTWHDMZ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|