C24H38N2O4 — CID 46469909
N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-4-hexoxy-3-methoxybenzamide (PubChem CID 46469909) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-4-hexoxy-3-methoxybenzamide.
| Compound Name | N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-4-hexoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 46469909 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | N-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]-4-hexoxy-3-methoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC2CCN(C(=O)C(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C24H38N2O4/c1-6-7-8-9-16-30-20-11-10-18(17-21(20)29-5)22(27)25-19-12-14-26(15-13-19)23(28)24(2,3)4/h10-11,17,19H,6-9,12-16H2,1-5H3,(H,25,27) |
| InChIKey | ITAZCJYPGWMPHA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|