C18H27NO3 — CID 51550324
3-methoxy-N-[(1R,2R)-2-methylcyclohexyl]-4-propan-2-yloxybenzamide (PubChem CID 51550324) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-methoxy-N-[(1R,2R)-2-methylcyclohexyl]-4-propan-2-yloxybenzamide.
| Compound Name | 3-methoxy-N-[(1R,2R)-2-methylcyclohexyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 51550324 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-methoxy-N-[(1R,2R)-2-methylcyclohexyl]-4-propan-2-yloxybenzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2CCCC[C@H]2C)ccc1OC(C)C |
| InChI | InChI=1S/C18H27NO3/c1-12(2)22-16-10-9-14(11-17(16)21-4)18(20)19-15-8-6-5-7-13(15)3/h9-13,15H,5-8H2,1-4H3,(H,19,20)/t13-,15-/m1/s1 |
| InChIKey | IVVRSBQBAHTFRP-UKRRQHHQSA-N |
| XLogP | 3.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |