C18H28N2O2 — CID 82070419
3-amino-N-(2-methylcyclohexyl)-4-(2-methylpropoxy)benzamide (PubChem CID 82070419) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-amino-N-(2-methylcyclohexyl)-4-(2-methylpropoxy)benzamide.
| Compound Name | 3-amino-N-(2-methylcyclohexyl)-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 82070419 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 3-amino-N-(2-methylcyclohexyl)-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NC2CCCCC2C)cc1N |
| InChI | InChI=1S/C18H28N2O2/c1-12(2)11-22-17-9-8-14(10-15(17)19)18(21)20-16-7-5-4-6-13(16)3/h8-10,12-13,16H,4-7,11,19H2,1-3H3,(H,20,21) |
| InChIKey | WHGKVEJBIFOOPQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|