C21H31NO5 — CID 42966109
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-methoxy-4-(2-methylpropoxy)benzoate (PubChem CID 42966109) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-methoxy-4-(2-methylpropoxy)benzoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-methoxy-4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 42966109 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-methoxy-4-(2-methylpropoxy)benzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NC2CCCCC2C)ccc1OCC(C)C |
| InChI | InChI=1S/C21H31NO5/c1-14(2)12-26-18-10-9-16(11-19(18)25-4)21(24)27-13-20(23)22-17-8-6-5-7-15(17)3/h9-11,14-15,17H,5-8,12-13H2,1-4H3,(H,22,23) |
| InChIKey | PLWPBTNKLQGSGP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |