C21H32N2O6S — CID 55321626
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 55321626) has the molecular formula C21H32N2O6S and a molecular weight of 440.56 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 55321626 |
| Molecular Formula | C21H32N2O6S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC2CCCCC2C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H32N2O6S/c1-14-8-6-7-9-16(14)22-19(24)13-29-20(25)15-10-11-17(28-5)18(12-15)30(26,27)23-21(2,3)4/h10-12,14,16,23H,6-9,13H2,1-5H3,(H,22,24) |
| InChIKey | SIWIAEWCXHFFKN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |