C20H27F3N2O4 — CID 51959294
4-butoxy-3-methoxy-N'-[(1S,3R)-3-(trifluoromethyl)cyclohexanecarbonyl]benzohydrazide (PubChem CID 51959294) has the molecular formula C20H27F3N2O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-butoxy-3-methoxy-N'-[(1S,3R)-3-(trifluoromethyl)cyclohexanecarbonyl]benzohydrazide.
| Compound Name | 4-butoxy-3-methoxy-N'-[(1S,3R)-3-(trifluoromethyl)cyclohexanecarbonyl]benzohydrazide |
|---|---|
| PubChem CID | 51959294 |
| Molecular Formula | C20H27F3N2O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 4-butoxy-3-methoxy-N'-[(1S,3R)-3-(trifluoromethyl)cyclohexanecarbonyl]benzohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)[C@H]2CCC[C@@H](C(F)(F)F)C2)cc1OC |
| InChI | InChI=1S/C20H27F3N2O4/c1-3-4-10-29-16-9-8-14(12-17(16)28-2)19(27)25-24-18(26)13-6-5-7-15(11-13)20(21,22)23/h8-9,12-13,15H,3-7,10-11H2,1-2H3,(H,24,26)(H,25,27)/t13-,15+/m0/s1 |
| InChIKey | OBSBXFDFDBXANA-DZGCQCFKSA-N |
| XLogP | 4.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|