C15H20N2O5S2 — CID 8938735
N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methoxy-4-methylsulfanylbenzohydrazide (PubChem CID 8938735) has the molecular formula C15H20N2O5S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methoxy-4-methylsulfanylbenzohydrazide.
| Compound Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methoxy-4-methylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 8938735 |
| Molecular Formula | C15H20N2O5S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methoxy-4-methylsulfanylbenzohydrazide |
| SMILES | COc1cc(SC)ccc1C(=O)NNC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O5S2/c1-22-13-8-11(23-2)3-4-12(13)15(19)17-16-14(18)7-10-5-6-24(20,21)9-10/h3-4,8,10H,5-7,9H2,1-2H3,(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | GHUIDVDSMHITEM-SNVBAGLBSA-N |
| XLogP | 1.00 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|