C18H26N2O7S — CID 46463707
N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-(3,4,5-trimethoxyphenyl)propanehydrazide (PubChem CID 46463707) has the molecular formula C18H26N2O7S and a molecular weight of 414.48 g/mol. Its IUPAC name is N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-(3,4,5-trimethoxyphenyl)propanehydrazide.
| Compound Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-(3,4,5-trimethoxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 46463707 |
| Molecular Formula | C18H26N2O7S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-(3,4,5-trimethoxyphenyl)propanehydrazide |
| SMILES | COc1cc(CCC(=O)NNC(=O)CC2CCS(=O)(=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C18H26N2O7S/c1-25-14-8-12(9-15(26-2)18(14)27-3)4-5-16(21)19-20-17(22)10-13-6-7-28(23,24)11-13/h8-9,13H,4-7,10-11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | GNNDAKKRVPEDRB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|