C16H19ClN2O7S — CID 8736101
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8736101) has the molecular formula C16H19ClN2O7S and a molecular weight of 418.86 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8736101 |
| Molecular Formula | C16H19ClN2O7S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H19ClN2O7S/c1-25-13-3-2-11(17)7-12(13)16(22)19-18-14(20)8-26-15(21)6-10-4-5-27(23,24)9-10/h2-3,7,10H,4-6,8-9H2,1H3,(H,18,20)(H,19,22)/t10-/m1/s1 |
| InChIKey | QGHUSUMWSWXSMM-SNVBAGLBSA-N |
| XLogP | 0.48 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|