C12H12Cl2O4S — CID 4668174
(2,4-dichlorophenyl) 2-(1,1-dioxothiolan-3-yl)acetate (PubChem CID 4668174) has the molecular formula C12H12Cl2O4S and a molecular weight of 323.20 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-(1,1-dioxothiolan-3-yl)acetate.
| Compound Name | (2,4-dichlorophenyl) 2-(1,1-dioxothiolan-3-yl)acetate |
|---|---|
| PubChem CID | 4668174 |
| Molecular Formula | C12H12Cl2O4S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | (2,4-dichlorophenyl) 2-(1,1-dioxothiolan-3-yl)acetate |
| SMILES | O=C(CC1CCS(=O)(=O)C1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O4S/c13-9-1-2-11(10(14)6-9)18-12(15)5-8-3-4-19(16,17)7-8/h1-2,6,8H,3-5,7H2 |
| InChIKey | WJFVNQZBAXPTIT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|