C13H18N2O4S — CID 61239465
N-(4-amino-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 61239465) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-(4-amino-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-(4-amino-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 61239465 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(4-amino-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | COc1cc(NC(=O)CC2CCS(=O)(=O)C2)ccc1N |
| InChI | InChI=1S/C13H18N2O4S/c1-19-12-7-10(2-3-11(12)14)15-13(16)6-9-4-5-20(17,18)8-9/h2-3,7,9H,4-6,8,14H2,1H3,(H,15,16) |
| InChIKey | SYHVKKPGBPSNBR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|