C15H21NO5S — CID 84577292
N-(3,4-dimethoxyphenyl)-2-(1,1-dioxothian-4-yl)acetamide (PubChem CID 84577292) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(1,1-dioxothian-4-yl)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(1,1-dioxothian-4-yl)acetamide |
|---|---|
| PubChem CID | 84577292 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(1,1-dioxothian-4-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2CCS(=O)(=O)CC2)cc1OC |
| InChI | InChI=1S/C15H21NO5S/c1-20-13-4-3-12(10-14(13)21-2)16-15(17)9-11-5-7-22(18,19)8-6-11/h3-4,10-11H,5-9H2,1-2H3,(H,16,17) |
| InChIKey | KACPHTHVSQQFNW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |