C13H16ClNO3S — CID 110858953
N-(4-chlorophenyl)-2-(1,1-dioxothian-4-yl)acetamide (PubChem CID 110858953) has the molecular formula C13H16ClNO3S and a molecular weight of 301.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(1,1-dioxothian-4-yl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(1,1-dioxothian-4-yl)acetamide |
|---|---|
| PubChem CID | 110858953 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-(1,1-dioxothian-4-yl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO3S/c14-11-1-3-12(4-2-11)15-13(16)9-10-5-7-19(17,18)8-6-10/h1-4,10H,5-9H2,(H,15,16) |
| InChIKey | UMBJIZYYTKVSGR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |