C13H17ClN2O3S — CID 43615220
N-(4-chlorophenyl)-2-[(1,1-dioxothian-4-yl)amino]acetamide (PubChem CID 43615220) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1,1-dioxothian-4-yl)amino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1,1-dioxothian-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 43615220 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1,1-dioxothian-4-yl)amino]acetamide |
| SMILES | O=C(CNC1CCS(=O)(=O)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O3S/c14-10-1-3-12(4-2-10)16-13(17)9-15-11-5-7-20(18,19)8-6-11/h1-4,11,15H,5-9H2,(H,16,17) |
| InChIKey | SKAPDSFCMJDWDQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |