C13H17FN2O3S — CID 43615218
2-[(1,1-dioxothian-4-yl)amino]-N-(3-fluorophenyl)acetamide (PubChem CID 43615218) has the molecular formula C13H17FN2O3S and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(1,1-dioxothian-4-yl)amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 43615218 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)amino]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(CNC1CCS(=O)(=O)CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2O3S/c14-10-2-1-3-12(8-10)16-13(17)9-15-11-4-6-20(18,19)7-5-11/h1-3,8,11,15H,4-7,9H2,(H,16,17) |
| InChIKey | ZTWIPJGQNPBRLH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |