C15H19FN2O3 — CID 63044439
3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 63044439) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63044439 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[[2-(3-fluoroanilino)-2-oxoethyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CNC1CCCC(C(=O)O)C1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN2O3/c16-11-4-2-6-13(8-11)18-14(19)9-17-12-5-1-3-10(7-12)15(20)21/h2,4,6,8,10,12,17H,1,3,5,7,9H2,(H,18,19)(H,20,21) |
| InChIKey | NYHOXCZGLYFWKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |