C41H44Cl4F2N2O2 — CID 167552414
bis(2-[4-(4-chloro-2-fluorophenyl)cyclohexyl]-N-(4-chlorophenyl)acetamide);methane (PubChem CID 167552414) has the molecular formula C41H44Cl4F2N2O2 and a molecular weight of 776.62 g/mol. Its IUPAC name is bis(2-[4-(4-chloro-2-fluorophenyl)cyclohexyl]-N-(4-chlorophenyl)acetamide);methane.
| Compound Name | bis(2-[4-(4-chloro-2-fluorophenyl)cyclohexyl]-N-(4-chlorophenyl)acetamide);methane |
|---|---|
| PubChem CID | 167552414 |
| Molecular Formula | C41H44Cl4F2N2O2 |
| Molecular Weight | 776.62 g/mol |
| Exact Mass | 774.21 |
| IUPAC Name | bis(2-[4-(4-chloro-2-fluorophenyl)cyclohexyl]-N-(4-chlorophenyl)acetamide);methane |
| SMILES | C.O=C(CC1CCC(c2ccc(Cl)cc2F)CC1)Nc1ccc(Cl)cc1.O=C(CC1CCC(c2ccc(Cl)cc2F)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/2C20H20Cl2FNO.CH4/c2*21-15-5-8-17(9-6-15)24-20(25)11-13-1-3-14(4-2-13)18-10-7-16(22)12-19(18)23;/h2*5-10,12-14H,1-4,11H2,(H,24,25);1H4 |
| InChIKey | COQSWRDHOPPUDO-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.62 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |