C22H26ClNO3 — CID 121324026
N-(4-chlorophenyl)-2-[4-(2,4-dimethoxyphenyl)cyclohexyl]acetamide (PubChem CID 121324026) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(2,4-dimethoxyphenyl)cyclohexyl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(2,4-dimethoxyphenyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 121324026 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(2,4-dimethoxyphenyl)cyclohexyl]acetamide |
| SMILES | COc1ccc(C2CCC(CC(=O)Nc3ccc(Cl)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H26ClNO3/c1-26-19-11-12-20(21(14-19)27-2)16-5-3-15(4-6-16)13-22(25)24-18-9-7-17(23)8-10-18/h7-12,14-16H,3-6,13H2,1-2H3,(H,24,25) |
| InChIKey | RWHMVOVWPGFZOX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |