C21H24ClNO — CID 161440636
N-(4-chlorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide (PubChem CID 161440636) has the molecular formula C21H24ClNO and a molecular weight of 341.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 161440636 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide |
| SMILES | Cc1cccc(C2CCC(CC(=O)Nc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C21H24ClNO/c1-15-3-2-4-18(13-15)17-7-5-16(6-8-17)14-21(24)23-20-11-9-19(22)10-12-20/h2-4,9-13,16-17H,5-8,14H2,1H3,(H,23,24) |
| InChIKey | VZFLHNCWRMGYLI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |