C22H23N3O2 — CID 138502772
N-(4-cyanophenyl)-2-[4-[3-(nitrosomethyl)phenyl]cyclohexyl]acetamide (PubChem CID 138502772) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[4-[3-(nitrosomethyl)phenyl]cyclohexyl]acetamide.
| Compound Name | N-(4-cyanophenyl)-2-[4-[3-(nitrosomethyl)phenyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 138502772 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-(4-cyanophenyl)-2-[4-[3-(nitrosomethyl)phenyl]cyclohexyl]acetamide |
| SMILES | N#Cc1ccc(NC(=O)CC2CCC(c3cccc(CN=O)c3)CC2)cc1 |
| InChI | InChI=1S/C22H23N3O2/c23-14-17-6-10-21(11-7-17)25-22(26)13-16-4-8-19(9-5-16)20-3-1-2-18(12-20)15-24-27/h1-3,6-7,10-12,16,19H,4-5,8-9,13,15H2,(H,25,26) |
| InChIKey | OAJYPAONYYBPHY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |