C21H23ClFNO — CID 146986934
N-(4-chloro-3-fluorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide (PubChem CID 146986934) has the molecular formula C21H23ClFNO and a molecular weight of 359.87 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 146986934 |
| Molecular Formula | C21H23ClFNO |
| Molecular Weight | 359.87 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-2-[4-(3-methylphenyl)cyclohexyl]acetamide |
| SMILES | Cc1cccc(C2CCC(CC(=O)Nc3ccc(Cl)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C21H23ClFNO/c1-14-3-2-4-17(11-14)16-7-5-15(6-8-16)12-21(25)24-18-9-10-19(22)20(23)13-18/h2-4,9-11,13,15-16H,5-8,12H2,1H3,(H,24,25) |
| InChIKey | APKZBZKOQMNYKV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.87 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |