C21H22ClNO3 — CID 121319777
3-[4-[2-(4-chloroanilino)-2-oxoethyl]cyclohexyl]benzoic acid (PubChem CID 121319777) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 3-[4-[2-(4-chloroanilino)-2-oxoethyl]cyclohexyl]benzoic acid.
| Compound Name | 3-[4-[2-(4-chloroanilino)-2-oxoethyl]cyclohexyl]benzoic acid |
|---|---|
| PubChem CID | 121319777 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[4-[2-(4-chloroanilino)-2-oxoethyl]cyclohexyl]benzoic acid |
| SMILES | O=C(CC1CCC(c2cccc(C(=O)O)c2)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClNO3/c22-18-8-10-19(11-9-18)23-20(24)12-14-4-6-15(7-5-14)16-2-1-3-17(13-16)21(25)26/h1-3,8-11,13-15H,4-7,12H2,(H,23,24)(H,25,26) |
| InChIKey | FUYBRYDEZDMMHY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |