C14H16ClF2NO — CID 121319752
N-(4-chlorophenyl)-2-(4,4-difluorocyclohexyl)acetamide (PubChem CID 121319752) has the molecular formula C14H16ClF2NO and a molecular weight of 287.74 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4,4-difluorocyclohexyl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(4,4-difluorocyclohexyl)acetamide |
|---|---|
| PubChem CID | 121319752 |
| Molecular Formula | C14H16ClF2NO |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4,4-difluorocyclohexyl)acetamide |
| SMILES | O=C(CC1CCC(F)(F)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClF2NO/c15-11-1-3-12(4-2-11)18-13(19)9-10-5-7-14(16,17)8-6-10/h1-4,10H,5-9H2,(H,18,19) |
| InChIKey | FMMNAHMRUZGRKG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |