C23H22ClFN2O2 — CID 145078404
N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]acetamide (PubChem CID 145078404) has the molecular formula C23H22ClFN2O2 and a molecular weight of 412.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 145078404 |
| Molecular Formula | C23H22ClFN2O2 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]acetamide |
| SMILES | O=C(CC1CCC(O)(c2ccnc3ccc(F)cc23)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClFN2O2/c24-16-1-4-18(5-2-16)27-22(28)13-15-7-10-23(29,11-8-15)20-9-12-26-21-6-3-17(25)14-19(20)21/h1-6,9,12,14-15,29H,7-8,10-11,13H2,(H,27,28) |
| InChIKey | NCFVRPOSZZXMIT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |