C24H23ClF2N2O — CID 121328328
N-(4-chlorophenyl)-2-[1-fluoro-4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 121328328) has the molecular formula C24H23ClF2N2O and a molecular weight of 428.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-fluoro-4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-fluoro-4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 121328328 |
| Molecular Formula | C24H23ClF2N2O |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-fluoro-4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Cl)cc1)C1(F)CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H23ClF2N2O/c1-15(23(30)29-19-5-2-17(25)3-6-19)24(27)11-8-16(9-12-24)20-10-13-28-22-7-4-18(26)14-21(20)22/h2-7,10,13-16H,8-9,11-12H2,1H3,(H,29,30) |
| InChIKey | CLTQCEYLLSJIAJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |