C24H24ClFN2O2 — CID 121328261
(2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]propanamide (PubChem CID 121328261) has the molecular formula C24H24ClFN2O2 and a molecular weight of 426.92 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]propanamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]propanamide |
|---|---|
| PubChem CID | 121328261 |
| Molecular Formula | C24H24ClFN2O2 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-4-hydroxycyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)C1CCC(O)(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H24ClFN2O2/c1-15(23(29)28-19-5-2-17(25)3-6-19)16-8-11-24(30,12-9-16)21-10-13-27-22-7-4-18(26)14-20(21)22/h2-7,10,13-16,30H,8-9,11-12H2,1H3,(H,28,29)/t15-,16?,24?/m1/s1 |
| InChIKey | ADDYCRSBNYACBT-MAXOOXIKSA-N |
| XLogP | 5.68 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |