C36H34ClN2OS+ — CID 153431284
[4-[4-[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]cyclohexyl]quinolin-6-yl]-diphenylsulfanium (PubChem CID 153431284) has the molecular formula C36H34ClN2OS+ and a molecular weight of 578.20 g/mol. Its IUPAC name is [4-[4-[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]cyclohexyl]quinolin-6-yl]-diphenylsulfanium.
| Compound Name | [4-[4-[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]cyclohexyl]quinolin-6-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 153431284 |
| Molecular Formula | C36H34ClN2OS+ |
| Molecular Weight | 578.20 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [4-[4-[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]cyclohexyl]quinolin-6-yl]-diphenylsulfanium |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)C1CCC(c2ccnc3ccc([S+](c4ccccc4)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C36H33ClN2OS/c1-25(36(40)39-29-18-16-28(37)17-19-29)26-12-14-27(15-13-26)33-22-23-38-35-21-20-32(24-34(33)35)41(30-8-4-2-5-9-30)31-10-6-3-7-11-31/h2-11,16-27H,12-15H2,1H3/p+1/t25-,26?,27?/m1/s1 |
| InChIKey | NDLIIDFTTAJIJQ-FKDZAPPDSA-O |
| XLogP | 9.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.20 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|