C21H24ClFN2O — CID 138490241
N-(4-chlorophenyl)-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanamide (PubChem CID 138490241) has the molecular formula C21H24ClFN2O and a molecular weight of 374.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 138490241 |
| Molecular Formula | C21H24ClFN2O |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(2-fluoro-3-methyl-4-pyridinyl)cyclohexyl]propanamide |
| SMILES | Cc1c(C2CCC(C(C)C(=O)Nc3ccc(Cl)cc3)CC2)ccnc1F |
| InChI | InChI=1S/C21H24ClFN2O/c1-13(21(26)25-18-9-7-17(22)8-10-18)15-3-5-16(6-4-15)19-11-12-24-20(23)14(19)2/h7-13,15-16H,3-6H2,1-2H3,(H,25,26) |
| InChIKey | OBMKGNJAQRDJGW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|