C26H30ClFN2O7S2 — CID 175788062
(2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide;ethane-1,2-disulfonic acid (PubChem CID 175788062) has the molecular formula C26H30ClFN2O7S2 and a molecular weight of 601.12 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide;ethane-1,2-disulfonic acid.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide;ethane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 175788062 |
| Molecular Formula | C26H30ClFN2O7S2 |
| Molecular Weight | 601.12 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide;ethane-1,2-disulfonic acid |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1.O=S(=O)(O)CCS(=O)(=O)O |
| InChI | InChI=1S/C24H24ClFN2O.C2H6O6S2/c1-15(24(29)28-20-9-6-18(25)7-10-20)16-2-4-17(5-3-16)21-12-13-27-23-11-8-19(26)14-22(21)23;3-9(4,5)1-2-10(6,7)8/h6-17H,2-5H2,1H3,(H,28,29);1-2H2,(H,3,4,5)(H,6,7,8)/t15-,16?,17?;/m1./s1 |
| InChIKey | WUBQTWJMOPXIKS-WNDXPBGESA-N |
| XLogP | 5.34 |
| TPSA | 150.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|