C25H27FN2O — CID 121333237
2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)propanamide (PubChem CID 121333237) has the molecular formula C25H27FN2O and a molecular weight of 390.50 g/mol. Its IUPAC name is 2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)propanamide.
| Compound Name | 2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 121333237 |
| Molecular Formula | C25H27FN2O |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)C(C)C2CCC(c3ccnc4ccc(F)cc34)CC2)c1 |
| InChI | InChI=1S/C25H27FN2O/c1-16-4-3-5-21(14-16)28-25(29)17(2)18-6-8-19(9-7-18)22-12-13-27-24-11-10-20(26)15-23(22)24/h3-5,10-15,17-19H,6-9H2,1-2H3,(H,28,29) |
| InChIKey | JDSVROJSWXKOGA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |