C25H31FN2O — CID 129088674
N-[(2S)-2-bicyclo[2.2.1]heptanyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 129088674) has the molecular formula C25H31FN2O and a molecular weight of 394.53 g/mol. Its IUPAC name is N-[(2S)-2-bicyclo[2.2.1]heptanyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | N-[(2S)-2-bicyclo[2.2.1]heptanyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 129088674 |
| Molecular Formula | C25H31FN2O |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[(2S)-2-bicyclo[2.2.1]heptanyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | CC(C(=O)N[C@H]1CC2CCC1C2)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C25H31FN2O/c1-15(25(29)28-24-13-16-2-3-19(24)12-16)17-4-6-18(7-5-17)21-10-11-27-23-9-8-20(26)14-22(21)23/h8-11,14-19,24H,2-7,12-13H2,1H3,(H,28,29)/t15?,16?,17?,18?,19?,24-/m0/s1 |
| InChIKey | MGJMQZLURKIHHG-FZCQFMHVSA-N |
| XLogP | 5.59 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |