C31H31FN2O — CID 138608756
(2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-[(4-phenylphenyl)methyl]propanamide (PubChem CID 138608756) has the molecular formula C31H31FN2O and a molecular weight of 466.60 g/mol. Its IUPAC name is (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-[(4-phenylphenyl)methyl]propanamide.
| Compound Name | (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-[(4-phenylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 138608756 |
| Molecular Formula | C31H31FN2O |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-[(4-phenylphenyl)methyl]propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(-c2ccccc2)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C31H31FN2O/c1-21(31(35)34-20-22-7-9-25(10-8-22)24-5-3-2-4-6-24)23-11-13-26(14-12-23)28-17-18-33-30-16-15-27(32)19-29(28)30/h2-10,15-19,21,23,26H,11-14,20H2,1H3,(H,34,35)/t21-,23?,26?/m1/s1 |
| InChIKey | OKUHJAOTZQZDDW-LAJDMCDJSA-N |
| XLogP | 7.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |