C30H29FN2O — CID 121332507
N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-2-phenylbenzamide (PubChem CID 121332507) has the molecular formula C30H29FN2O and a molecular weight of 452.57 g/mol. Its IUPAC name is N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-2-phenylbenzamide.
| Compound Name | N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 121332507 |
| Molecular Formula | C30H29FN2O |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-2-phenylbenzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1-c1ccccc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C30H29FN2O/c1-20(33-30(34)27-10-6-5-9-25(27)22-7-3-2-4-8-22)21-11-13-23(14-12-21)26-17-18-32-29-16-15-24(31)19-28(26)29/h2-10,15-21,23H,11-14H2,1H3,(H,33,34)/t20-,21?,23?/m1/s1 |
| InChIKey | ZLTZBFGYWGADGS-HVIUMASTSA-N |
| XLogP | 7.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |