C24H31FN2O2 — CID 175886025
N-[(1S)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-hydroxycyclohexane-1-carboxamide (PubChem CID 175886025) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is N-[(1S)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-hydroxycyclohexane-1-carboxamide.
| Compound Name | N-[(1S)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 175886025 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N-[(1S)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]-4-hydroxycyclohexane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1CCC(O)CC1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H31FN2O2/c1-15(27-24(29)18-6-9-20(28)10-7-18)16-2-4-17(5-3-16)21-12-13-26-23-11-8-19(25)14-22(21)23/h8,11-18,20,28H,2-7,9-10H2,1H3,(H,27,29)/t15-,16?,17?,18?,20?/m0/s1 |
| InChIKey | IENWFYGNINDDIO-CCLIWJKGSA-N |
| XLogP | 4.70 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |