C20H25FN2O2 — CID 142752025
(2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-methoxy-N-methylpropanamide (PubChem CID 142752025) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-methoxy-N-methylpropanamide.
| Compound Name | (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 142752025 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2R)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-methoxy-N-methylpropanamide |
| SMILES | CON(C)C(=O)[C@H](C)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C20H25FN2O2/c1-13(20(24)23(2)25-3)14-4-6-15(7-5-14)17-10-11-22-19-9-8-16(21)12-18(17)19/h8-15H,4-7H2,1-3H3/t13-,14?,15?/m1/s1 |
| InChIKey | HOTCWOJQHLYDGG-WLYUNCDWSA-N |
| XLogP | 4.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|