C24H24F3N3O — CID 154634623
N-(2-amino-4,5-difluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 154634623) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is N-(2-amino-4,5-difluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | N-(2-amino-4,5-difluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 154634623 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-(2-amino-4,5-difluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | CC(C(=O)Nc1cc(F)c(F)cc1N)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C24H24F3N3O/c1-13(24(31)30-23-12-20(27)19(26)11-21(23)28)14-2-4-15(5-3-14)17-8-9-29-22-7-6-16(25)10-18(17)22/h6-15H,2-5,28H2,1H3,(H,30,31) |
| InChIKey | AQXVNGCGOLLKNL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|