C23H22ClFN2O — CID 121318796
N-[(4-chlorophenyl)methyl]-4-(6-fluoroquinolin-4-yl)cyclohexane-1-carboxamide (PubChem CID 121318796) has the molecular formula C23H22ClFN2O and a molecular weight of 396.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-(6-fluoroquinolin-4-yl)cyclohexane-1-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-(6-fluoroquinolin-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121318796 |
| Molecular Formula | C23H22ClFN2O |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-(6-fluoroquinolin-4-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C23H22ClFN2O/c24-18-7-1-15(2-8-18)14-27-23(28)17-5-3-16(4-6-17)20-11-12-26-22-10-9-19(25)13-21(20)22/h1-2,7-13,16-17H,3-6,14H2,(H,27,28) |
| InChIKey | ZSQSTAUGTIIYFO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |