C22H21ClFN3O — CID 139429318
N'-(4-chlorophenyl)-4-(6-fluoroquinolin-4-yl)-N-hydroxycyclohexane-1-carboximidamide (PubChem CID 139429318) has the molecular formula C22H21ClFN3O and a molecular weight of 397.88 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-4-(6-fluoroquinolin-4-yl)-N-hydroxycyclohexane-1-carboximidamide.
| Compound Name | N'-(4-chlorophenyl)-4-(6-fluoroquinolin-4-yl)-N-hydroxycyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 139429318 |
| Molecular Formula | C22H21ClFN3O |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N'-(4-chlorophenyl)-4-(6-fluoroquinolin-4-yl)-N-hydroxycyclohexane-1-carboximidamide |
| SMILES | ON/C(=N\c1ccc(Cl)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C22H21ClFN3O/c23-16-5-8-18(9-6-16)26-22(27-28)15-3-1-14(2-4-15)19-11-12-25-21-10-7-17(24)13-20(19)21/h5-15,28H,1-4H2,(H,26,27) |
| InChIKey | AXYMAONUKYOGFV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|