C27H28FN3O — CID 153351367
2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-hydroxy-N'-(4-prop-2-ynylphenyl)propanimidamide (PubChem CID 153351367) has the molecular formula C27H28FN3O and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-hydroxy-N'-(4-prop-2-ynylphenyl)propanimidamide.
| Compound Name | 2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-hydroxy-N'-(4-prop-2-ynylphenyl)propanimidamide |
|---|---|
| PubChem CID | 153351367 |
| Molecular Formula | C27H28FN3O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-hydroxy-N'-(4-prop-2-ynylphenyl)propanimidamide |
| SMILES | C#CCc1ccc(/N=C(\NO)C(C)C2CCC(c3ccnc4ccc(F)cc34)CC2)cc1 |
| InChI | InChI=1S/C27H28FN3O/c1-3-4-19-5-12-23(13-6-19)30-27(31-32)18(2)20-7-9-21(10-8-20)24-15-16-29-26-14-11-22(28)17-25(24)26/h1,5-6,11-18,20-21,32H,4,7-10H2,2H3,(H,30,31) |
| InChIKey | IMYKPNSNBLJLQS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|