C26H28ClFN2 — CID 155416442
4-chloro-N-[3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]pent-1-en-2-yl]aniline (PubChem CID 155416442) has the molecular formula C26H28ClFN2 and a molecular weight of 422.98 g/mol. Its IUPAC name is 4-chloro-N-[3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]pent-1-en-2-yl]aniline.
| Compound Name | 4-chloro-N-[3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]pent-1-en-2-yl]aniline |
|---|---|
| PubChem CID | 155416442 |
| Molecular Formula | C26H28ClFN2 |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-chloro-N-[3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]pent-1-en-2-yl]aniline |
| SMILES | C=C(Nc1ccc(Cl)cc1)C(CC)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C26H28ClFN2/c1-3-23(17(2)30-22-11-8-20(27)9-12-22)18-4-6-19(7-5-18)24-14-15-29-26-13-10-21(28)16-25(24)26/h8-16,18-19,23,30H,2-7H2,1H3 |
| InChIKey | QDHKBQCDKBWELO-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |