C18H25FN2 — CID 142561485
ethane;[4-(6-fluoroquinolin-4-yl)cyclohexyl]methanamine (PubChem CID 142561485) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is ethane;[4-(6-fluoroquinolin-4-yl)cyclohexyl]methanamine.
| Compound Name | ethane;[4-(6-fluoroquinolin-4-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 142561485 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | ethane;[4-(6-fluoroquinolin-4-yl)cyclohexyl]methanamine |
| SMILES | CC.NCC1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C16H19FN2.C2H6/c17-13-5-6-16-15(9-13)14(7-8-19-16)12-3-1-11(10-18)2-4-12;1-2/h5-9,11-12H,1-4,10,18H2;1-2H3 |
| InChIKey | HNRZHWUMPMVGKL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |