C21H27FN2OS — CID 174048964
tert-butyl-[2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethylideneamino]-oxidosulfanium (PubChem CID 174048964) has the molecular formula C21H27FN2OS and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl-[2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174048964 |
| Molecular Formula | C21H27FN2OS |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl-[2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethylideneamino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N=CCC1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C21H27FN2OS/c1-21(2,3)26(25)24-13-10-15-4-6-16(7-5-15)18-11-12-23-20-9-8-17(22)14-19(18)20/h8-9,11-16H,4-7,10H2,1-3H3 |
| InChIKey | SCQSMWMOXLCUQV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|