C20H28FN3 — CID 175080471
1-tert-butyl-2-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]hydrazine (PubChem CID 175080471) has the molecular formula C20H28FN3 and a molecular weight of 329.46 g/mol. Its IUPAC name is 1-tert-butyl-2-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]hydrazine.
| Compound Name | 1-tert-butyl-2-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]hydrazine |
|---|---|
| PubChem CID | 175080471 |
| Molecular Formula | C20H28FN3 |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 1-tert-butyl-2-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]hydrazine |
| SMILES | CC(C)(C)NNCC1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C20H28FN3/c1-20(2,3)24-23-13-14-4-6-15(7-5-14)17-10-11-22-19-9-8-16(21)12-18(17)19/h8-12,14-15,23-24H,4-7,13H2,1-3H3 |
| InChIKey | LWKGNZINXSBPDZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|