C29H28ClFN2O — CID 145397632
N-benzyl-4-chlorobenzamide;4-cyclohexyl-6-fluoroquinoline (PubChem CID 145397632) has the molecular formula C29H28ClFN2O and a molecular weight of 475.01 g/mol. Its IUPAC name is N-benzyl-4-chlorobenzamide;4-cyclohexyl-6-fluoroquinoline.
| Compound Name | N-benzyl-4-chlorobenzamide;4-cyclohexyl-6-fluoroquinoline |
|---|---|
| PubChem CID | 145397632 |
| Molecular Formula | C29H28ClFN2O |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-benzyl-4-chlorobenzamide;4-cyclohexyl-6-fluoroquinoline |
| SMILES | Fc1ccc2nccc(C3CCCCC3)c2c1.O=C(NCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16FN.C14H12ClNO/c16-12-6-7-15-14(10-12)13(8-9-17-15)11-4-2-1-3-5-11;15-13-8-6-12(7-9-13)14(17)16-10-11-4-2-1-3-5-11/h6-11H,1-5H2;1-9H,10H2,(H,16,17) |
| InChIKey | IQRNOMWLFALUBB-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |