C16H15FN2O3 — CID 138687677
2-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-2-oxoacetic acid (PubChem CID 138687677) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 138687677 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C16H15FN2O3/c17-11-1-2-14-13(9-11)12(3-6-18-14)10-4-7-19(8-5-10)15(20)16(21)22/h1-3,6,9-10H,4-5,7-8H2,(H,21,22) |
| InChIKey | CMWKCGWQSLYKFF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|