C25H25F2N3O — CID 139408558
N-(4-fluorophenyl)-1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]cyclobutane-1-carboxamide (PubChem CID 139408558) has the molecular formula C25H25F2N3O and a molecular weight of 421.49 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]cyclobutane-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 139408558 |
| Molecular Formula | C25H25F2N3O |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(4-fluorophenyl)-1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C1(N2CCC(c3ccnc4ccc(F)cc34)CC2)CCC1 |
| InChI | InChI=1S/C25H25F2N3O/c26-18-2-5-20(6-3-18)29-24(31)25(11-1-12-25)30-14-9-17(10-15-30)21-8-13-28-23-7-4-19(27)16-22(21)23/h2-8,13,16-17H,1,9-12,14-15H2,(H,29,31) |
| InChIKey | NSEAFQHEWORRCQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |