C25H23F4N3O — CID 139408582
1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-N-(3,4,5-trifluorophenyl)cyclobutane-1-carboxamide (PubChem CID 139408582) has the molecular formula C25H23F4N3O and a molecular weight of 457.47 g/mol. Its IUPAC name is 1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-N-(3,4,5-trifluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-N-(3,4,5-trifluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 139408582 |
| Molecular Formula | C25H23F4N3O |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[4-(6-fluoroquinolin-4-yl)piperidin-1-yl]-N-(3,4,5-trifluorophenyl)cyclobutane-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)C1(N2CCC(c3ccnc4ccc(F)cc34)CC2)CCC1 |
| InChI | InChI=1S/C25H23F4N3O/c26-16-2-3-22-19(12-16)18(4-9-30-22)15-5-10-32(11-6-15)25(7-1-8-25)24(33)31-17-13-20(27)23(29)21(28)14-17/h2-4,9,12-15H,1,5-8,10-11H2,(H,31,33) |
| InChIKey | OJQAGMINMSHOJM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|