C23H21F2N3O — CID 155221367
N-(4-fluorophenyl)-6-(6-fluoroquinolin-4-yl)-1-azaspiro[2.5]octane-1-carboxamide (PubChem CID 155221367) has the molecular formula C23H21F2N3O and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-(6-fluoroquinolin-4-yl)-1-azaspiro[2.5]octane-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-(6-fluoroquinolin-4-yl)-1-azaspiro[2.5]octane-1-carboxamide |
|---|---|
| PubChem CID | 155221367 |
| Molecular Formula | C23H21F2N3O |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(4-fluorophenyl)-6-(6-fluoroquinolin-4-yl)-1-azaspiro[2.5]octane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1CC12CCC(c1ccnc3ccc(F)cc13)CC2 |
| InChI | InChI=1S/C23H21F2N3O/c24-16-1-4-18(5-2-16)27-22(29)28-14-23(28)10-7-15(8-11-23)19-9-12-26-21-6-3-17(25)13-20(19)21/h1-6,9,12-13,15H,7-8,10-11,14H2,(H,27,29) |
| InChIKey | SNBARBWGFCVMRC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 45.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|