C23H21ClFN3O — CID 147211398
(2S)-N-(6-chloro-3-pyridinyl)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octane-2-carboxamide (PubChem CID 147211398) has the molecular formula C23H21ClFN3O and a molecular weight of 409.89 g/mol. Its IUPAC name is (2S)-N-(6-chloro-3-pyridinyl)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-N-(6-chloro-3-pyridinyl)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 147211398 |
| Molecular Formula | C23H21ClFN3O |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (2S)-N-(6-chloro-3-pyridinyl)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octane-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)[C@H]1CC12CCC(c1ccnc3ccc(F)cc13)CC2 |
| InChI | InChI=1S/C23H21ClFN3O/c24-21-4-2-16(13-27-21)28-22(29)19-12-23(19)8-5-14(6-9-23)17-7-10-26-20-3-1-15(25)11-18(17)20/h1-4,7,10-11,13-14,19H,5-6,8-9,12H2,(H,28,29)/t14?,19-,23?/m1/s1 |
| InChIKey | CFGMCNHQXDHGKD-JIMJETOSSA-N |
| XLogP | 5.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|